C27H48O7P2 — CID 11969878
[(3S,8S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphono hydrogen phosphate (PubChem CID 11969878) has the molecular formula C27H48O7P2 and a molecular weight of 546.62 g/mol. Its IUPAC name is [(3S,8S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphono hydrogen phosphate.
| Compound Name | [(3S,8S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11969878 |
| Molecular Formula | C27H48O7P2 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | [(3S,8S,10R,13R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phosphono hydrogen phosphate |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2[C@@H]3CC=C4C[C@@H](OP(=O)(O)OP(=O)(O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H48O7P2/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(33-36(31,32)34-35(28,29)30)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25H,6-8,10-17H2,1-5H3,(H,31,32)(H2,28,29,30)/t19-,21+,22+,23?,24?,25?,26+,27-/m1/s1 |
| InChIKey | ZJLOQNLOYNEWTK-FXSLSZKUSA-N |
| XLogP | 7.62 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|