C30H53O6P — CID 10187200
[3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxypropyl] dihydrogen phosphate (PubChem CID 10187200) has the molecular formula C30H53O6P and a molecular weight of 540.72 g/mol. Its IUPAC name is [3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxypropyl] dihydrogen phosphate.
| Compound Name | [3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxypropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10187200 |
| Molecular Formula | C30H53O6P |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | [3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2-hydroxypropyl] dihydrogen phosphate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OCC(O)COP(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H53O6P/c1-20(2)7-6-8-21(3)26-11-12-27-25-10-9-22-17-24(35-18-23(31)19-36-37(32,33)34)13-15-29(22,4)28(25)14-16-30(26,27)5/h9,20-21,23-28,31H,6-8,10-19H2,1-5H3,(H2,32,33,34)/t21-,23?,24+,25+,26-,27+,28+,29+,30-/m1/s1 |
| InChIKey | HEPKCFSEWYUTHL-LLACCSHGSA-N |
| XLogP | 6.88 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|