C30H51NO3 — CID 90721932
(2S)-2-amino-3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid (PubChem CID 90721932) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid.
| Compound Name | (2S)-2-amino-3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 90721932 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | (2S)-2-amino-3-[[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]propanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC[C@H](N)C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H51NO3/c1-19(2)7-6-8-20(3)24-11-12-25-23-10-9-21-17-22(34-18-27(31)28(32)33)13-15-29(21,4)26(23)14-16-30(24,25)5/h9,19-20,22-27H,6-8,10-18,31H2,1-5H3,(H,32,33)/t20-,22+,23+,24-,25+,26+,27+,29+,30-/m1/s1 |
| InChIKey | HWQQTJWMFNJSPC-AJCWMCFNSA-N |
| XLogP | 6.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|