C33H54O4 — CID 90160012
4-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 90160012) has the molecular formula C33H54O4 and a molecular weight of 514.79 g/mol. Its IUPAC name is 4-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90160012 |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.40 |
| IUPAC Name | 4-[[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4CC(OC(=O)C(C)C(C)C(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H54O4/c1-20(2)9-8-10-21(3)27-13-14-28-26-12-11-24-19-25(37-31(36)23(5)22(4)30(34)35)15-17-32(24,6)29(26)16-18-33(27,28)7/h11,20-23,25-29H,8-10,12-19H2,1-7H3,(H,34,35)/t21-,22?,23?,25?,26+,27-,28+,29+,32+,33-/m1/s1 |
| InChIKey | DAQCHKHOYGJPBK-NQPATOGKSA-N |
| XLogP | 8.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|