C30H49BrO2 — CID 51052111
[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-bromopropanoate (PubChem CID 51052111) has the molecular formula C30H49BrO2 and a molecular weight of 521.62 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-bromopropanoate.
| Compound Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-bromopropanoate |
|---|---|
| PubChem CID | 51052111 |
| Molecular Formula | C30H49BrO2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-bromopropanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)C(C)Br)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H49BrO2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(33-28(32)21(4)31)14-16-29(22,5)27(24)15-17-30(25,26)6/h10,19-21,23-27H,7-9,11-18H2,1-6H3/t20-,21?,23+,24?,25-,26?,27?,29+,30-/m1/s1 |
| InChIKey | HQCIIKWOMRRRPN-QFDOZQGZSA-N |
| XLogP | 8.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|