C32H53BrO2 — CID 124903932
[(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-bromopentanoate (PubChem CID 124903932) has the molecular formula C32H53BrO2 and a molecular weight of 549.68 g/mol. Its IUPAC name is [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-bromopentanoate.
| Compound Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-bromopentanoate |
|---|---|
| PubChem CID | 124903932 |
| Molecular Formula | C32H53BrO2 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | [(3S,8R,9R,10R,13R,14R,17S)-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2S)-2-bromopentanoate |
| SMILES | CCC[C@H](Br)C(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@H]4CC[C@@H]([C@@H](C)CCCC(C)C)[C@@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C32H53BrO2/c1-7-9-29(33)30(34)35-24-16-18-31(5)23(20-24)12-13-25-27-15-14-26(22(4)11-8-10-21(2)3)32(27,6)19-17-28(25)31/h12,21-22,24-29H,7-11,13-20H2,1-6H3/t22-,24-,25+,26-,27+,28+,29-,31-,32+/m0/s1 |
| InChIKey | HNLMHAUNUCSDSQ-QWGKTMRZSA-N |
| XLogP | 9.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|