C33H56O2 — CID 22796166
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylpentanoate (PubChem CID 22796166) has the molecular formula C33H56O2 and a molecular weight of 484.81 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylpentanoate.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylpentanoate |
|---|---|
| PubChem CID | 22796166 |
| Molecular Formula | C33H56O2 |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 484.43 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C33H56O2/c1-8-10-24(5)31(34)35-26-17-19-32(6)25(21-26)13-14-27-29-16-15-28(23(4)12-9-11-22(2)3)33(29,7)20-18-30(27)32/h13,22-24,26-30H,8-12,14-21H2,1-7H3/t23-,24?,26?,27?,28-,29?,30?,32+,33-/m1/s1 |
| InChIKey | HOVZBGJEVIECFR-WHFLDINNSA-N |
| XLogP | 9.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|