C30H51NO2 — CID 166170877
[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminopropanoate (PubChem CID 166170877) has the molecular formula C30H51NO2 and a molecular weight of 457.74 g/mol. Its IUPAC name is [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminopropanoate.
| Compound Name | [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminopropanoate |
|---|---|
| PubChem CID | 166170877 |
| Molecular Formula | C30H51NO2 |
| Molecular Weight | 457.74 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | [10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminopropanoate |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CC=C4CC(OC(=O)C(C)N)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H51NO2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(33-28(32)21(4)31)14-16-29(22,5)27(24)15-17-30(25,26)6/h10,19-21,23-27H,7-9,11-18,31H2,1-6H3/t20-,21?,23?,24?,25?,26?,27?,29?,30?/m1/s1 |
| InChIKey | PLPILXJIRNEWOA-QNCLDVRXSA-N |
| XLogP | 7.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.74 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|