C28H49O6P — CID 155089173
[(3S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl dihydrogen phosphate (PubChem CID 155089173) has the molecular formula C28H49O6P and a molecular weight of 512.67 g/mol. Its IUPAC name is [(3S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl dihydrogen phosphate.
| Compound Name | [(3S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155089173 |
| Molecular Formula | C28H49O6P |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | [(3S,9S,10R,13R,14S,17R)-17-[(2R)-6-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxymethyl dihydrogen phosphate |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2C3CC=C4C[C@@H](OCOP(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H49O6P/c1-19(7-6-14-26(2,3)29)23-10-11-24-22-9-8-20-17-21(33-18-34-35(30,31)32)12-15-27(20,4)25(22)13-16-28(23,24)5/h8,19,21-25,29H,6-7,9-18H2,1-5H3,(H2,30,31,32)/t19-,21+,22?,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | LYDMLCCBZBATNV-AAMLSXOSSA-N |
| XLogP | 6.59 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|