C28H48O2 — CID 172575127
(6R)-6-[(3S,8S,10R,13R)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol (PubChem CID 172575127) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (6R)-6-[(3S,8S,10R,13R)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(3S,8S,10R,13R)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 172575127 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (6R)-6-[(3S,8S,10R,13R)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-ol |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CC[C@H]3C4CCC([C@H](C)CCCC(C)(C)O)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C28H48O2/c1-19(8-7-15-26(2,3)29)23-11-12-24-22-10-9-20-18-21(30-6)13-16-27(20,4)25(22)14-17-28(23,24)5/h9,19,21-25,29H,7-8,10-18H2,1-6H3/t19-,21+,22+,23?,24?,25?,27+,28-/m1/s1 |
| InChIKey | ICKQMIJINGRWRF-HFKRSZPOSA-N |
| XLogP | 7.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|