C32H55NO2 — CID 176575134
3,4-dihydroxypentanenitrile;3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 176575134) has the molecular formula C32H55NO2 and a molecular weight of 485.80 g/mol. Its IUPAC name is 3,4-dihydroxypentanenitrile;3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | 3,4-dihydroxypentanenitrile;3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 176575134 |
| Molecular Formula | C32H55NO2 |
| Molecular Weight | 485.80 g/mol |
| Exact Mass | 485.42 |
| IUPAC Name | 3,4-dihydroxypentanenitrile;3,10,13-trimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(C)CCC4(C)C3CCC12C.CC(O)C(O)CC#N |
| InChI | InChI=1S/C27H46.C5H9NO2/c1-19(2)8-6-7-9-21-11-13-24-23-12-10-22-18-20(3)14-16-27(22,5)25(23)15-17-26(21,24)4;1-4(7)5(8)2-3-6/h10,19-21,23-25H,6-9,11-18H2,1-5H3;4-5,7-8H,2H2,1H3 |
| InChIKey | TYZAZPJPJVQDGN-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.80 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|