C30H49IO2 — CID 138552038
[(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-iodobutanoate (PubChem CID 138552038) has the molecular formula C30H49IO2 and a molecular weight of 568.62 g/mol. Its IUPAC name is [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-iodobutanoate.
| Compound Name | [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-iodobutanoate |
|---|---|
| PubChem CID | 138552038 |
| Molecular Formula | C30H49IO2 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.28 |
| IUPAC Name | [(8S,10R,13R,17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-iodobutanoate |
| SMILES | CC(C)CCCC[C@H]1CCC2[C@@H]3CC=C4CC(OC(=O)CCCI)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H49IO2/c1-21(2)8-5-6-9-22-12-14-26-25-13-11-23-20-24(33-28(32)10-7-19-31)15-17-30(23,4)27(25)16-18-29(22,26)3/h11,21-22,24-27H,5-10,12-20H2,1-4H3/t22-,24?,25-,26?,27?,29+,30-/m0/s1 |
| InChIKey | RKCUBOBVNSXYFT-YMOPCKNISA-N |
| XLogP | 8.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|