C30H48O3S2 — CID 170107177
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(2-oxoethyldisulfanyl)acetate (PubChem CID 170107177) has the molecular formula C30H48O3S2 and a molecular weight of 520.85 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(2-oxoethyldisulfanyl)acetate.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(2-oxoethyldisulfanyl)acetate |
|---|---|
| PubChem CID | 170107177 |
| Molecular Formula | C30H48O3S2 |
| Molecular Weight | 520.85 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-(2-oxoethyldisulfanyl)acetate |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)CSSCC=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H48O3S2/c1-21(2)7-5-6-8-22-10-12-26-25-11-9-23-19-24(33-28(32)20-35-34-18-17-31)13-15-30(23,4)27(25)14-16-29(22,26)3/h9,17,21-22,24-27H,5-8,10-16,18-20H2,1-4H3 |
| InChIKey | DOXPCAARCKQUTN-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.85 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|