C35H61NO5 — CID 144759586
2-[2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl-(2-methoxy-2-oxoethyl)amino]acetic acid;ethane (PubChem CID 144759586) has the molecular formula C35H61NO5 and a molecular weight of 575.88 g/mol. Its IUPAC name is 2-[2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl-(2-methoxy-2-oxoethyl)amino]acetic acid;ethane.
| Compound Name | 2-[2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl-(2-methoxy-2-oxoethyl)amino]acetic acid;ethane |
|---|---|
| PubChem CID | 144759586 |
| Molecular Formula | C35H61NO5 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 575.45 |
| IUPAC Name | 2-[2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl-(2-methoxy-2-oxoethyl)amino]acetic acid;ethane |
| SMILES | CC.COC(=O)CN(CCOC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1)CC(=O)O |
| InChI | InChI=1S/C33H55NO5.C2H6/c1-23(2)8-6-7-9-24-11-13-28-27-12-10-25-20-26(14-16-33(25,4)29(27)15-17-32(24,28)3)39-19-18-34(21-30(35)36)22-31(37)38-5;1-2/h10,23-24,26-29H,6-9,11-22H2,1-5H3,(H,35,36);1-2H3 |
| InChIKey | IUUVYXZOFCIYRH-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|