C41H76N4O2 — CID 169146221
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-aminopentyl)-N-[4-(3-aminopentylamino)butyl]carbamate (PubChem CID 169146221) has the molecular formula C41H76N4O2 and a molecular weight of 657.09 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-aminopentyl)-N-[4-(3-aminopentylamino)butyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-aminopentyl)-N-[4-(3-aminopentylamino)butyl]carbamate |
|---|---|
| PubChem CID | 169146221 |
| Molecular Formula | C41H76N4O2 |
| Molecular Weight | 657.09 g/mol |
| Exact Mass | 656.60 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-aminopentyl)-N-[4-(3-aminopentylamino)butyl]carbamate |
| SMILES | CCC(N)CCNCCCCN(CCC(N)CC)C(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C41H76N4O2/c1-7-33(42)21-26-44-25-11-12-27-45(28-22-34(43)8-2)39(46)47-35-19-23-41(6)32(29-35)15-17-36-37-18-16-31(14-10-9-13-30(3)4)40(37,5)24-20-38(36)41/h15,30-31,33-38,44H,7-14,16-29,42-43H2,1-6H3 |
| InChIKey | NPVMYRKOGDMWSW-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.09 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|