C38H73N7O2 — CID 121400705
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis[4-(diaminomethylamino)butyl]carbamate (PubChem CID 121400705) has the molecular formula C38H73N7O2 and a molecular weight of 660.05 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis[4-(diaminomethylamino)butyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis[4-(diaminomethylamino)butyl]carbamate |
|---|---|
| PubChem CID | 121400705 |
| Molecular Formula | C38H73N7O2 |
| Molecular Weight | 660.05 g/mol |
| Exact Mass | 659.58 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis[4-(diaminomethylamino)butyl]carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)N(CCCCNC(N)N)CCCCNC(N)N)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H73N7O2/c1-26(2)11-10-12-27(3)31-15-16-32-30-14-13-28-25-29(17-19-37(28,4)33(30)18-20-38(31,32)5)47-36(46)45(23-8-6-21-43-34(39)40)24-9-7-22-44-35(41)42/h13,26-27,29-35,43-44H,6-12,14-25,39-42H2,1-5H3 |
| InChIKey | CXALRPWBVHUNGV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.05 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|