C38H53NO9 — CID 166979914
4-O-[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(4-nitrophenoxy)carbonyloxymethyl] butanedioate (PubChem CID 166979914) has the molecular formula C38H53NO9 and a molecular weight of 667.84 g/mol. Its IUPAC name is 4-O-[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(4-nitrophenoxy)carbonyloxymethyl] butanedioate.
| Compound Name | 4-O-[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(4-nitrophenoxy)carbonyloxymethyl] butanedioate |
|---|---|
| PubChem CID | 166979914 |
| Molecular Formula | C38H53NO9 |
| Molecular Weight | 667.84 g/mol |
| Exact Mass | 667.37 |
| IUPAC Name | 4-O-[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 1-O-[(4-nitrophenoxy)carbonyloxymethyl] butanedioate |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)CCC(=O)OCOC(=O)Oc5ccc([N+](=O)[O-])cc5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H53NO9/c1-25(2)7-5-6-8-26-10-16-32-31-15-9-27-23-30(19-21-38(27,4)33(31)20-22-37(26,32)3)47-35(41)18-17-34(40)45-24-46-36(42)48-29-13-11-28(12-14-29)39(43)44/h9,11-14,25-26,30-33H,5-8,10,15-24H2,1-4H3 |
| InChIKey | CGYYIFJTPSKYKQ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 131.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.84 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|