C34H55ClN2O5 — CID 166876663
chloromethyl 4-[2-[[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]-4-oxobutanoate (PubChem CID 166876663) has the molecular formula C34H55ClN2O5 and a molecular weight of 607.28 g/mol. Its IUPAC name is chloromethyl 4-[2-[[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]-4-oxobutanoate.
| Compound Name | chloromethyl 4-[2-[[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 166876663 |
| Molecular Formula | C34H55ClN2O5 |
| Molecular Weight | 607.28 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | chloromethyl 4-[2-[[(17S)-10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethylamino]-4-oxobutanoate |
| SMILES | CC(C)CCCC[C@H]1CCC2C3CC=C4CC(OC(=O)NCCNC(=O)CCC(=O)OCCl)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C34H55ClN2O5/c1-23(2)7-5-6-8-24-10-12-28-27-11-9-25-21-26(15-17-34(25,4)29(27)16-18-33(24,28)3)42-32(40)37-20-19-36-30(38)13-14-31(39)41-22-35/h9,23-24,26-29H,5-8,10-22H2,1-4H3,(H,36,38)(H,37,40)/t24-,26?,27?,28?,29?,33?,34?/m0/s1 |
| InChIKey | BWZXUSWKXADHAD-MHPYMYFNSA-N |
| XLogP | 7.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.28 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|