C33H55NO8 — CID 77434121
2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyl 2,3,4,4-tetrahydroxybutanoate (PubChem CID 77434121) has the molecular formula C33H55NO8 and a molecular weight of 593.80 g/mol. Its IUPAC name is 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyl 2,3,4,4-tetrahydroxybutanoate.
| Compound Name | 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyl 2,3,4,4-tetrahydroxybutanoate |
|---|---|
| PubChem CID | 77434121 |
| Molecular Formula | C33H55NO8 |
| Molecular Weight | 593.80 g/mol |
| Exact Mass | 593.39 |
| IUPAC Name | 2-[[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]ethyl 2,3,4,4-tetrahydroxybutanoate |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)NCCOC(=O)C(O)C(O)C(O)O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H55NO8/c1-20(2)7-5-6-8-21-10-12-25-24-11-9-22-19-23(13-15-33(22,4)26(24)14-16-32(21,25)3)42-31(40)34-17-18-41-30(39)28(36)27(35)29(37)38/h9,20-21,23-29,35-38H,5-8,10-19H2,1-4H3,(H,34,40) |
| InChIKey | JETFUHGMZZGULQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|