C41H70N3O4+ — CID 170974254
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(4-aminophenyl)-ethoxymethoxy]ethyl]carbamate;trimethylazanium (PubChem CID 170974254) has the molecular formula C41H70N3O4+ and a molecular weight of 669.03 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(4-aminophenyl)-ethoxymethoxy]ethyl]carbamate;trimethylazanium.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(4-aminophenyl)-ethoxymethoxy]ethyl]carbamate;trimethylazanium |
|---|---|
| PubChem CID | 170974254 |
| Molecular Formula | C41H70N3O4+ |
| Molecular Weight | 669.03 g/mol |
| Exact Mass | 668.54 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[(4-aminophenyl)-ethoxymethoxy]ethyl]carbamate;trimethylazanium |
| SMILES | CCOC(OCCNC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(CCCCC(C)C)CCC32)C1)c1ccc(N)cc1.C[NH+](C)C |
| InChI | InChI=1S/C38H60N2O4.C3H9N/c1-6-42-35(27-11-15-30(39)16-12-27)43-24-23-40-36(41)44-31-19-21-38(5)29(25-31)13-17-32-33-18-14-28(10-8-7-9-26(2)3)37(33,4)22-20-34(32)38;1-4(2)3/h11-13,15-16,26,28,31-35H,6-10,14,17-25,39H2,1-5H3,(H,40,41);1-3H3/p+1 |
| InChIKey | MLHLIABRHLSMSZ-UHFFFAOYSA-O |
| XLogP | 7.97 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.03 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|