C35H62N2O3 — CID 169146324
[17-(4-ethyl-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate (PubChem CID 169146324) has the molecular formula C35H62N2O3 and a molecular weight of 558.89 g/mol. Its IUPAC name is [17-(4-ethyl-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate.
| Compound Name | [17-(4-ethyl-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 169146324 |
| Molecular Formula | C35H62N2O3 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.48 |
| IUPAC Name | [17-(4-ethyl-5-methylhexyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
| SMILES | CCC(CCCC1CCC2C3CC=C4CC(OC(=O)NCCOCCN(C)C)CCC4(C)C3CCC12C)C(C)C |
| InChI | InChI=1S/C35H62N2O3/c1-8-26(25(2)3)10-9-11-27-13-15-31-30-14-12-28-24-29(40-33(38)36-20-22-39-23-21-37(6)7)16-18-35(28,5)32(30)17-19-34(27,31)4/h12,25-27,29-32H,8-11,13-24H2,1-7H3,(H,36,38) |
| InChIKey | QSIPEBLJPQKKFU-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|