C30H47Cl3O2 — CID 166838093
[(3S,8S,9S,10R,13R,14S,17S)-17-[(4R)-4-ethyl-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroacetate (PubChem CID 166838093) has the molecular formula C30H47Cl3O2 and a molecular weight of 546.06 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17S)-17-[(4R)-4-ethyl-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroacetate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17S)-17-[(4R)-4-ethyl-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 166838093 |
| Molecular Formula | C30H47Cl3O2 |
| Molecular Weight | 546.06 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17S)-17-[(4R)-4-ethyl-5-methylhexyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2,2,2-trichloroacetate |
| SMILES | CC[C@H](CCC[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)C(Cl)(Cl)Cl)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C30H47Cl3O2/c1-6-20(19(2)3)8-7-9-21-11-13-25-24-12-10-22-18-23(35-27(34)30(31,32)33)14-16-29(22,5)26(24)15-17-28(21,25)4/h10,19-21,23-26H,6-9,11-18H2,1-5H3/t20-,21+,23+,24+,25+,26+,28-,29+/m1/s1 |
| InChIKey | PTZXBTHZTIPDGI-HNAUWVITSA-N |
| XLogP | 9.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.06 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|