C35H61N3O3 — CID 167446600
[10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]carbamate (PubChem CID 167446600) has the molecular formula C35H61N3O3 and a molecular weight of 571.89 g/mol. Its IUPAC name is [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 167446600 |
| Molecular Formula | C35H61N3O3 |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.47 |
| IUPAC Name | [10,13-dimethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl]carbamate |
| SMILES | CC(C)CCCCC1CCC2C3CC=C4CC(OC(=O)NCCN5CCN(CCO)CC5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H61N3O3/c1-26(2)7-5-6-8-27-10-12-31-30-11-9-28-25-29(13-15-35(28,4)32(30)14-16-34(27,31)3)41-33(40)36-17-18-37-19-21-38(22-20-37)23-24-39/h9,26-27,29-32,39H,5-8,10-25H2,1-4H3,(H,36,40) |
| InChIKey | WCSJYNZTFLYZGL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|