C31H53NO3 — CID 143714503
[(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-hydroxypropyl)carbamate (PubChem CID 143714503) has the molecular formula C31H53NO3 and a molecular weight of 487.77 g/mol. Its IUPAC name is [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-hydroxypropyl)carbamate.
| Compound Name | [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-hydroxypropyl)carbamate |
|---|---|
| PubChem CID | 143714503 |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.40 |
| IUPAC Name | [(10R,13R)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(3-hydroxypropyl)carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCO)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C31H53NO3/c1-21(2)8-6-9-22(3)26-12-13-27-25-11-10-23-20-24(35-29(34)32-18-7-19-33)14-16-30(23,4)28(25)15-17-31(26,27)5/h10,21-22,24-28,33H,6-9,11-20H2,1-5H3,(H,32,34)/t22?,24?,25?,26?,27?,28?,30-,31+/m0/s1 |
| InChIKey | LOQBFXSUAYISNO-IIPYNTGOSA-N |
| XLogP | 7.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|