C35H59NO4 — CID 135302685
methyl 6-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexanoate (PubChem CID 135302685) has the molecular formula C35H59NO4 and a molecular weight of 557.86 g/mol. Its IUPAC name is methyl 6-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexanoate.
| Compound Name | methyl 6-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 135302685 |
| Molecular Formula | C35H59NO4 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 557.44 |
| IUPAC Name | methyl 6-[[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H59NO4/c1-24(2)11-10-12-25(3)29-16-17-30-28-15-14-26-23-27(18-20-34(26,4)31(28)19-21-35(29,30)5)40-33(38)36-22-9-7-8-13-32(37)39-6/h14,24-25,27-31H,7-13,15-23H2,1-6H3,(H,36,38)/t25-,27+,28?,29-,30?,31?,34+,35-/m1/s1 |
| InChIKey | AIPXXQJLCOEMPH-SZNRLZBSSA-N |
| XLogP | 8.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|