C30H52N2O2 — CID 137452520
[(3R,10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate (PubChem CID 137452520) has the molecular formula C30H52N2O2 and a molecular weight of 472.76 g/mol. Its IUPAC name is [(3R,10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate.
| Compound Name | [(3R,10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate |
|---|---|
| PubChem CID | 137452520 |
| Molecular Formula | C30H52N2O2 |
| Molecular Weight | 472.76 g/mol |
| Exact Mass | 472.40 |
| IUPAC Name | [(3R,10S,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(2-aminoethyl)carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C[C@H](OC(=O)NCCN)CC[C@@]4(C)C3CC[C@@]12C |
| InChI | InChI=1S/C30H52N2O2/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(34-28(33)32-18-17-31)13-15-29(22,4)27(24)14-16-30(25,26)5/h9,20-21,23-27H,6-8,10-19,31H2,1-5H3,(H,32,33)/t21?,23-,24?,25?,26?,27?,29-,30+/m1/s1 |
| InChIKey | QYFPQEYHSUDNAS-YYRCCQCWSA-N |
| XLogP | 7.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.76 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|