C38H68N4O2 — CID 10167868
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]carbamate (PubChem CID 10167868) has the molecular formula C38H68N4O2 and a molecular weight of 612.99 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 10167868 |
| Molecular Formula | C38H68N4O2 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 612.53 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[3-[4-(3-aminopropyl)piperazin-1-yl]propyl]carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCN5CCN(CCCN)CC5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H68N4O2/c1-28(2)9-6-10-29(3)33-13-14-34-32-12-11-30-27-31(15-17-37(30,4)35(32)16-18-38(33,34)5)44-36(43)40-20-8-22-42-25-23-41(24-26-42)21-7-19-39/h11,28-29,31-35H,6-10,12-27,39H2,1-5H3,(H,40,43) |
| InChIKey | URBNMRIYDVKMLQ-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|