C35H61N3O2 — CID 168884095
[(3S,8S,9S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate (PubChem CID 168884095) has the molecular formula C35H61N3O2 and a molecular weight of 555.89 g/mol. Its IUPAC name is [(3S,8S,9S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate.
| Compound Name | [(3S,8S,9S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 168884095 |
| Molecular Formula | C35H61N3O2 |
| Molecular Weight | 555.89 g/mol |
| Exact Mass | 555.48 |
| IUPAC Name | [(3S,8S,9S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-methylpiperazin-1-yl)ethyl]carbamate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)NCCN5CCN(C)CC5)CCC4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H61N3O2/c1-25(2)8-7-9-26(3)30-12-13-31-29-11-10-27-24-28(14-16-34(27,4)32(29)15-17-35(30,31)5)40-33(39)36-18-19-38-22-20-37(6)21-23-38/h10,25-26,28-32H,7-9,11-24H2,1-6H3,(H,36,39)/t26-,28+,29+,30-,31+,32+,34?,35-/m1/s1 |
| InChIKey | SSHBLSXZLBUNKL-MFDCNVIFSA-N |
| XLogP | 7.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.89 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|