C32H57N2O2+ — CID 18335784
4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]butylazanium (PubChem CID 18335784) has the molecular formula C32H57N2O2+ and a molecular weight of 501.82 g/mol. Its IUPAC name is 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]butylazanium.
| Compound Name | 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]butylazanium |
|---|---|
| PubChem CID | 18335784 |
| Molecular Formula | C32H57N2O2+ |
| Molecular Weight | 501.82 g/mol |
| Exact Mass | 501.44 |
| IUPAC Name | 4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]butylazanium |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCC[NH3+])CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H56N2O2/c1-22(2)9-8-10-23(3)27-13-14-28-26-12-11-24-21-25(36-30(35)34-20-7-6-19-33)15-17-31(24,4)29(26)16-18-32(27,28)5/h11,22-23,25-29H,6-10,12-21,33H2,1-5H3,(H,34,35)/p+1 |
| InChIKey | LLDCAXZHLXJXRP-UHFFFAOYSA-O |
| XLogP | 7.14 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.82 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|