C35H61NO2 — CID 145157363
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(4,4-dimethylpentyl)carbamate (PubChem CID 145157363) has the molecular formula C35H61NO2 and a molecular weight of 527.88 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(4,4-dimethylpentyl)carbamate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(4,4-dimethylpentyl)carbamate |
|---|---|
| PubChem CID | 145157363 |
| Molecular Formula | C35H61NO2 |
| Molecular Weight | 527.88 g/mol |
| Exact Mass | 527.47 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(4,4-dimethylpentyl)carbamate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCC(C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C35H61NO2/c1-24(2)11-9-12-25(3)29-15-16-30-28-14-13-26-23-27(38-32(37)36-22-10-19-33(4,5)6)17-20-34(26,7)31(28)18-21-35(29,30)8/h13,24-25,27-31H,9-12,14-23H2,1-8H3,(H,36,37) |
| InChIKey | HWDZYKRYRJRHKJ-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.88 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|