C34H56N2O4 — CID 121356938
[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-oxobutanoylamino)ethyl]carbamate (PubChem CID 121356938) has the molecular formula C34H56N2O4 and a molecular weight of 556.83 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-oxobutanoylamino)ethyl]carbamate.
| Compound Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-oxobutanoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 121356938 |
| Molecular Formula | C34H56N2O4 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-[2-(4-oxobutanoylamino)ethyl]carbamate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)NCCNC(=O)CCC=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H56N2O4/c1-23(2)8-6-9-24(3)28-13-14-29-27-12-11-25-22-26(15-17-33(25,4)30(27)16-18-34(28,29)5)40-32(39)36-20-19-35-31(38)10-7-21-37/h11,21,23-24,26-30H,6-10,12-20,22H2,1-5H3,(H,35,38)(H,36,39)/t24-,26+,27?,28-,29?,30?,33+,34-/m1/s1 |
| InChIKey | ACTWTMPCMNJZCN-YQWFICTCSA-N |
| XLogP | 7.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|