C33H54N2O5 — CID 22846193
2-[3-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propanoylamino]acetic acid (PubChem CID 22846193) has the molecular formula C33H54N2O5 and a molecular weight of 558.80 g/mol. Its IUPAC name is 2-[3-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propanoylamino]acetic acid.
| Compound Name | 2-[3-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 22846193 |
| Molecular Formula | C33H54N2O5 |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.40 |
| IUPAC Name | 2-[3-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]propanoylamino]acetic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(OC(=O)NCCC(=O)NCC(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C33H54N2O5/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-24(13-16-32(23,4)28(25)14-17-33(26,27)5)40-31(39)34-18-15-29(36)35-20-30(37)38/h9,21-22,24-28H,6-8,10-20H2,1-5H3,(H,34,39)(H,35,36)(H,37,38)/t22-,24?,25?,26-,27?,28?,32+,33-/m1/s1 |
| InChIKey | JJCWWYIBXUHONU-FDPWFEDJSA-N |
| XLogP | 6.71 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|