C33H53NO5 — CID 77465191
2-[[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]acetic acid (PubChem CID 77465191) has the molecular formula C33H53NO5 and a molecular weight of 543.79 g/mol. Its IUPAC name is 2-[[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 77465191 |
| Molecular Formula | C33H53NO5 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.39 |
| IUPAC Name | 2-[[4-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoyl]amino]acetic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCC(=O)NCC(=O)O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H53NO5/c1-21(2)7-6-8-22(3)26-11-12-27-25-10-9-23-19-24(39-31(38)14-13-29(35)34-20-30(36)37)15-17-32(23,4)28(25)16-18-33(26,27)5/h9,21-22,24-28H,6-8,10-20H2,1-5H3,(H,34,35)(H,36,37) |
| InChIKey | VUVJFVUNKXUPJN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|