C40H62O3 — CID 44662587
[(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-hexylphenyl) carbonate (PubChem CID 44662587) has the molecular formula C40H62O3 and a molecular weight of 590.93 g/mol. Its IUPAC name is [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-hexylphenyl) carbonate.
| Compound Name | [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-hexylphenyl) carbonate |
|---|---|
| PubChem CID | 44662587 |
| Molecular Formula | C40H62O3 |
| Molecular Weight | 590.93 g/mol |
| Exact Mass | 590.47 |
| IUPAC Name | [(3S,10R,13R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (4-hexylphenyl) carbonate |
| SMILES | CCCCCCCCC1CCC2C3CC=C4C[C@@H](OC(=O)Oc5ccc(CCCCCC)cc5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C40H62O3/c1-5-7-9-11-12-14-16-31-20-24-36-35-23-19-32-29-34(25-27-40(32,4)37(35)26-28-39(31,36)3)43-38(41)42-33-21-17-30(18-22-33)15-13-10-8-6-2/h17-19,21-22,31,34-37H,5-16,20,23-29H2,1-4H3/t31?,34-,35?,36?,37?,39+,40-/m0/s1 |
| InChIKey | KUYJAUBIDWYCSR-SXGIJKRSSA-N |
| XLogP | 12.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.93 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|