C35H52O3 — CID 162941470
[(3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-methylphenyl) carbonate (PubChem CID 162941470) has the molecular formula C35H52O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-methylphenyl) carbonate.
| Compound Name | [(3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-methylphenyl) carbonate |
|---|---|
| PubChem CID | 162941470 |
| Molecular Formula | C35H52O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 520.39 |
| IUPAC Name | [(3S,8R,9S,10R,13R,14S,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-methylphenyl) carbonate |
| SMILES | CCCCCCCC[C@@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)Oc5ccccc5C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H52O3/c1-5-6-7-8-9-10-14-26-17-19-30-29-18-16-27-24-28(37-33(36)38-32-15-12-11-13-25(32)2)20-22-35(27,4)31(29)21-23-34(26,30)3/h11-13,15-16,26,28-31H,5-10,14,17-24H2,1-4H3/t26-,28+,29-,30+,31+,34-,35+/m1/s1 |
| InChIKey | ZMWGTNHAGAIBGN-YTTVHPSFSA-N |
| XLogP | 10.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|