C36H54O3 — CID 163046450
[(3S,8R,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-ethylphenyl) carbonate (PubChem CID 163046450) has the molecular formula C36H54O3 and a molecular weight of 534.83 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-ethylphenyl) carbonate.
| Compound Name | [(3S,8R,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-ethylphenyl) carbonate |
|---|---|
| PubChem CID | 163046450 |
| Molecular Formula | C36H54O3 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.41 |
| IUPAC Name | [(3S,8R,9S,10R,13R,14S,17S)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (2-ethylphenyl) carbonate |
| SMILES | CCCCCCCC[C@H]1CC[C@H]2[C@H]3CC=C4C[C@@H](OC(=O)Oc5ccccc5CC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H54O3/c1-5-7-8-9-10-11-15-27-18-20-31-30-19-17-28-25-29(21-23-36(28,4)32(30)22-24-35(27,31)3)38-34(37)39-33-16-13-12-14-26(33)6-2/h12-14,16-17,27,29-32H,5-11,15,18-25H2,1-4H3/t27-,29-,30+,31-,32-,35+,36-/m0/s1 |
| InChIKey | OMBFCVGPKRDEAE-ZLIKXMDVSA-N |
| XLogP | 10.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|