C21H27F3O5S — CID 57238424
(8S,9R,10R,13S,14S)-10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid (PubChem CID 57238424) has the molecular formula C21H27F3O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid.
| Compound Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid |
|---|---|
| PubChem CID | 57238424 |
| Molecular Formula | C21H27F3O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | (8S,9R,10R,13S,14S)-10,13-dimethyl-3-(trifluoromethylsulfonyloxy)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2-carboxylic acid |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC=C3C=C(OS(=O)(=O)C(F)(F)F)C(C(=O)O)C[C@]3(C)[C@@H]1CC2 |
| InChI | InChI=1S/C21H27F3O5S/c1-19-8-3-4-15(19)13-6-5-12-10-17(29-30(27,28)21(22,23)24)14(18(25)26)11-20(12,2)16(13)7-9-19/h5,10,13-16H,3-4,6-9,11H2,1-2H3,(H,25,26)/t13-,14?,15-,16+,19-,20-/m0/s1 |
| InChIKey | LGURLAHWLFABPL-FSIHYXCMSA-N |
| XLogP | 5.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|