C20H27F3O3S — CID 89060069
[(10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 89060069) has the molecular formula C20H27F3O3S and a molecular weight of 404.49 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89060069 |
| Molecular Formula | C20H27F3O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CCC3C(CC=C4C=CCC[C@@]43C)C1CCC2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H27F3O3S/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(19(15,2)12-10-16(14)18)26-27(24,25)20(21,22)23/h3,5-6,14-17H,4,7-12H2,1-2H3/t14?,15?,16?,17?,18-,19-/m0/s1 |
| InChIKey | IJKHRKGNJZDUOW-DGGYFRSASA-N |
| XLogP | 5.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|