C19H26O — CID 141222017
(8S,9S,10R,13S,14S,17S)-10-methyl-1,2,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde (PubChem CID 141222017) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-10-methyl-1,2,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde.
| Compound Name | (8S,9S,10R,13S,14S,17S)-10-methyl-1,2,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
|---|---|
| PubChem CID | 141222017 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-10-methyl-1,2,7,8,9,11,12,13,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
| SMILES | C[C@]12CCC=CC1=CC[C@H]1[C@@H]3CC[C@H](C=O)[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C19H26O/c1-19-11-3-2-4-14(19)6-8-17-16-7-5-13(12-20)15(16)9-10-18(17)19/h2,4,6,12-13,15-18H,3,5,7-11H2,1H3/t13-,15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | PEWZRFMYSYOVHJ-IGERKEGBSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|