C20H26O — CID 66886858
(8R,9S,10R,13S,14S)-10,13-dimethyl-16-methylidene-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 66886858) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-16-methylidene-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-16-methylidene-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 66886858 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-16-methylidene-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C=C1C[C@H]2[C@@H]3CC=C4C=CCC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C20H26O/c1-13-12-17-15-8-7-14-6-4-5-10-19(14,2)16(15)9-11-20(17,3)18(13)21/h4,6-7,15-17H,1,5,8-12H2,2-3H3/t15-,16+,17+,19+,20+/m1/s1 |
| InChIKey | GLOWVUBGXBCHPC-ORZNMBHWSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|