C29H40O — CID 70149091
(8S,9S,10R,13S,14S,16S,17R)-10,13-dimethyl-17-(4-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-16-ol (PubChem CID 70149091) has the molecular formula C29H40O and a molecular weight of 404.64 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16S,17R)-10,13-dimethyl-17-(4-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-16-ol.
| Compound Name | (8S,9S,10R,13S,14S,16S,17R)-10,13-dimethyl-17-(4-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 70149091 |
| Molecular Formula | C29H40O |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (8S,9S,10R,13S,14S,16S,17R)-10,13-dimethyl-17-(4-phenylbutan-2-yl)-2,7,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-16-ol |
| SMILES | CC(CCc1ccccc1)[C@H]1[C@@H](O)C[C@H]2[C@@H]3CC=C4C=CCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H40O/c1-20(12-13-21-9-5-4-6-10-21)27-26(30)19-25-23-15-14-22-11-7-8-17-28(22,2)24(23)16-18-29(25,27)3/h4-7,9-11,14,20,23-27,30H,8,12-13,15-19H2,1-3H3/t20?,23-,24+,25+,26+,27+,28+,29+/m1/s1 |
| InChIKey | BNWWJESUFVYIPE-DBXZGHPXSA-N |
| XLogP | 6.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |