C29H48O — CID 70149080
(8S,9S,10R,13S,14S,16S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-ol (PubChem CID 70149080) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-ol.
| Compound Name | (8S,9S,10R,13S,14S,16S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 70149080 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (8S,9S,10R,13S,14S,16S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1[C@@H](O)C[C@H]2[C@@H]3CC=C4C(C)(C)C=CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H48O/c1-19(2)10-8-11-20(3)26-24(30)18-23-21-12-13-25-27(4,5)15-9-16-28(25,6)22(21)14-17-29(23,26)7/h9,13,15,19-24,26,30H,8,10-12,14,16-18H2,1-7H3/t20-,21-,22+,23+,24+,26+,28-,29+/m1/s1 |
| InChIKey | YMYTVIHMDJSRGC-JSKJNKGGSA-N |
| XLogP | 7.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|