C27H42O — CID 536413
10,13-dimethyl-17-(6-methylheptan-2-yl)-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-one (PubChem CID 536413) has the molecular formula C27H42O and a molecular weight of 382.63 g/mol. Its IUPAC name is 10,13-dimethyl-17-(6-methylheptan-2-yl)-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-one.
| Compound Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-one |
|---|---|
| PubChem CID | 536413 |
| Molecular Formula | C27H42O |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.32 |
| IUPAC Name | 10,13-dimethyl-17-(6-methylheptan-2-yl)-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-4-one |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C(=O)C=CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H42O/c1-18(2)8-6-9-19(3)21-13-14-22-20-11-12-24-25(28)10-7-16-26(24,4)23(20)15-17-27(21,22)5/h7,10,12,18-23H,6,8-9,11,13-17H2,1-5H3 |
| InChIKey | IQTIUONKROTYPE-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |