C27H34O2S — CID 151296985
(8R,9S,10R,13S,14S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 151296985) has the molecular formula C27H34O2S and a molecular weight of 422.63 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (8R,9S,10R,13S,14S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 151296985 |
| Molecular Formula | C27H34O2S |
| Molecular Weight | 422.63 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-[2-(benzenesulfonyl)ethyl]-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CCC=CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(CCS(=O)(=O)c3ccccc3)=CC[C@@H]12 |
| InChI | InChI=1S/C27H34O2S/c1-26-17-7-6-8-20(26)11-13-23-24-14-12-21(27(24,2)18-15-25(23)26)16-19-30(28,29)22-9-4-3-5-10-22/h3-6,8-12,23-25H,7,13-19H2,1-2H3/t23-,24-,25-,26-,27+/m0/s1 |
| InChIKey | OBPNRNBWLOQHBY-JSLVBRCRSA-N |
| XLogP | 6.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|