C24H36O2 — CID 163030541
(8R,9S,10R,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-1,2,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163030541) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-1,2,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-1,2,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163030541 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (8R,9S,10R,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-1,2,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4C(C)(C)C(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H36O2/c1-15(25)16-9-13-24(6)18-7-8-19-21(2,3)20(26)11-12-22(19,4)17(18)10-14-23(16,24)5/h8,16-18H,7,9-14H2,1-6H3/t16-,17+,18-,22-,23-,24+/m1/s1 |
| InChIKey | XITWYGYWFIVTIE-KNGVNFKHSA-N |
| XLogP | 5.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|