C22H34O — CID 121403119
1-[(3aS,3bR,5aS,6R,8aR,8bS)-1,3a,5a,8a-tetramethyl-3,3b,4,5,6,7,8,8b,9,10-decahydro-2H-indeno[5,4-e]inden-6-yl]ethanone (PubChem CID 121403119) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-[(3aS,3bR,5aS,6R,8aR,8bS)-1,3a,5a,8a-tetramethyl-3,3b,4,5,6,7,8,8b,9,10-decahydro-2H-indeno[5,4-e]inden-6-yl]ethanone.
| Compound Name | 1-[(3aS,3bR,5aS,6R,8aR,8bS)-1,3a,5a,8a-tetramethyl-3,3b,4,5,6,7,8,8b,9,10-decahydro-2H-indeno[5,4-e]inden-6-yl]ethanone |
|---|---|
| PubChem CID | 121403119 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 1-[(3aS,3bR,5aS,6R,8aR,8bS)-1,3a,5a,8a-tetramethyl-3,3b,4,5,6,7,8,8b,9,10-decahydro-2H-indeno[5,4-e]inden-6-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC[C@]2(C)[C@H]3CCC4=C(C)CC[C@@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C22H34O/c1-14-8-11-20(3)16(14)6-7-19-18(20)10-13-21(4)17(15(2)23)9-12-22(19,21)5/h17-19H,6-13H2,1-5H3/t17-,18+,19-,20+,21-,22+/m0/s1 |
| InChIKey | MSCIJTBXYUVGEU-VTJKKSGASA-N |
| XLogP | 5.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|