C20H28O3 — CID 69424787
(1R,2S,4S,6R,7S,10S,11R)-6,15-dihydroxy-7,11-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one (PubChem CID 69424787) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (1R,2S,4S,6R,7S,10S,11R)-6,15-dihydroxy-7,11-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one.
| Compound Name | (1R,2S,4S,6R,7S,10S,11R)-6,15-dihydroxy-7,11-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 69424787 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (1R,2S,4S,6R,7S,10S,11R)-6,15-dihydroxy-7,11-dimethylpentacyclo[8.8.0.02,4.02,7.011,16]octadec-15-en-14-one |
| SMILES | C[C@]12CCC(=O)C(O)=C1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@H](O)C[C@@H]3C[C@]312 |
| InChI | InChI=1S/C20H28O3/c1-18-7-6-15(21)17(23)14(18)4-3-13-12(18)5-8-19(2)16(22)9-11-10-20(11,13)19/h11-13,16,22-23H,3-10H2,1-2H3/t11-,12+,13-,16-,18-,19-,20+/m1/s1 |
| InChIKey | YPXJQINVTDRWCZ-HAWLKQDESA-N |
| XLogP | 3.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |