C19H25NO3 — CID 25022852
2-[(2S,4aS,4bR,10aR)-2-formyl-8-hydroxy-2,4b-dimethyl-7-oxo-3,4,4a,5,6,9,10,10a-octahydro-1H-phenanthren-1-yl]acetonitrile (PubChem CID 25022852) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-[(2S,4aS,4bR,10aR)-2-formyl-8-hydroxy-2,4b-dimethyl-7-oxo-3,4,4a,5,6,9,10,10a-octahydro-1H-phenanthren-1-yl]acetonitrile.
| Compound Name | 2-[(2S,4aS,4bR,10aR)-2-formyl-8-hydroxy-2,4b-dimethyl-7-oxo-3,4,4a,5,6,9,10,10a-octahydro-1H-phenanthren-1-yl]acetonitrile |
|---|---|
| PubChem CID | 25022852 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-[(2S,4aS,4bR,10aR)-2-formyl-8-hydroxy-2,4b-dimethyl-7-oxo-3,4,4a,5,6,9,10,10a-octahydro-1H-phenanthren-1-yl]acetonitrile |
| SMILES | C[C@]1(C=O)CC[C@H]2[C@@H](CCC3=C(O)C(=O)CC[C@@]32C)C1CC#N |
| InChI | InChI=1S/C19H25NO3/c1-18(11-21)8-5-14-12(13(18)7-10-20)3-4-15-17(23)16(22)6-9-19(14,15)2/h11-14,23H,3-9H2,1-2H3/t12-,13?,14-,18+,19+/m0/s1 |
| InChIKey | UXHCLIDMFYHRIY-PZAJFETHSA-N |
| XLogP | 3.72 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|