C22H26F8O2 — CID 87879836
(8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 87879836) has the molecular formula C22H26F8O2 and a molecular weight of 474.43 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 87879836 |
| Molecular Formula | C22H26F8O2 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-hydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C(C(F)(F)F)=C1CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H26F8O2/c1-17-8-7-15(31)16(20(23,24)25)14(17)4-3-11-12(17)5-9-18(2)13(11)6-10-19(18,32)21(26,27)22(28,29)30/h11-13,32H,3-10H2,1-2H3/t11-,12-,13+,17-,18+,19?/m1/s1 |
| InChIKey | AXRMRMXOTBUZGB-SRPYJJBNSA-N |
| XLogP | 6.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|