C21H25F5O3 — CID 10180422
(10R,13S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 10180422) has the molecular formula C21H25F5O3 and a molecular weight of 420.42 g/mol. Its IUPAC name is (10R,13S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (10R,13S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 10180422 |
| Molecular Formula | C21H25F5O3 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | (10R,13S,17R)-4,17-dihydroxy-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C(O)=C1CCC1C2CC[C@@]2(C)C1CC[C@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H25F5O3/c1-17-8-7-15(27)16(28)14(17)4-3-11-12(17)5-9-18(2)13(11)6-10-19(18,29)20(22,23)21(24,25)26/h7-8,11-13,28-29H,3-6,9-10H2,1-2H3/t11?,12?,13?,17-,18+,19-/m1/s1 |
| InChIKey | RQQVPXOOPZEYEI-JXCIVZLHSA-N |
| XLogP | 5.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|